* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-ISOPROPYL-5-METHYL-4,4A,5,6,7,8-HEXAHYDRONAPHTHALEN-2(3H)-ONE |
| CAS: | 4726-45-8 |
| English Synonyms: | 8-ISOPROPYL-5-METHYL-4,4A,5,6,7,8-HEXAHYDRONAPHTHALEN-2(3H)-ONE |
| MDL Number.: | MFCD17010018 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | CC1CCC(C2=CC(=O)CCC12)C(C)C |
| InChi: | InChI=1S/C14H22O/c1-9(2)12-6-4-10(3)13-7-5-11(15)8-14(12)13/h8-10,12-13H,4-7H2,1-3H3 |
| InChiKey: | InChIKey=AQNMVDGKNNYAEW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.