* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2,3-DIHYDRO-1-BENZOFURAN-2,3-DIONE |
| CAS: | 4732-72-3 |
| English Synonyms: | 2,3-DIHYDRO-1-BENZOFURAN-2,3-DIONE ; 2,3-BENZOFURANDIONE |
| MDL Number.: | MFCD09035228 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | c1ccc2c(c1)C(=O)C(=O)O2 |
| InChi: | InChI=1S/C8H4O3/c9-7-5-3-1-2-4-6(5)11-8(7)10/h1-4H |
| InChiKey: | InChIKey=UUISWLJHAJBRAA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.