* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SPEGATRINE |
CAS: | 47326-53-4 |
English Synonyms: | SPEGATRINE |
MDL Number.: | MFCD00238537 |
H bond acceptor: | 4 |
H bond donor: | 3 |
Smile: | C/C=C\1/C[N+]2([C@H]3Cc4c5cc(ccc5[nH]c4[C@@H]2C[C@H]1[C@H]3CO)O)C |
InChi: | InChI=1S/C20H24N2O2/c1-3-11-9-22(2)18-8-15-14-6-12(24)4-5-17(14)21-20(15)19(22)7-13(11)16(18)10-23/h3-6,13,16,18-19,21,23H,7-10H2,1-2H3/p+1/b11-3-/t13-,16-,18+,19+,22?/m1/s1 |
InChiKey: | InChIKey=DOTYYDUNWITJSJ-KBBMJICXSA-O |
* If the product has intellectual property rights, a license granted is must or contact us.