* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | (4E)-1,5-DIPHENYLPENT-4-EN-1-ONE |
| CAS: | 4746-09-2 |
| English Synonyms: | 1,5-DIPHENYL-4-PENTEN-1-ONE ; (4E)-1,5-DIPHENYLPENT-4-EN-1-ONE |
| MDL Number.: | MFCD00030048 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | c1ccc(cc1)/C=C/CCC(=O)c2ccccc2 |
| InChi: | InChI=1S/C17H16O/c18-17(16-12-5-2-6-13-16)14-8-7-11-15-9-3-1-4-10-15/h1-7,9-13H,8,14H2/b11-7+ |
| InChiKey: | InChIKey=FZVGNXFZRZIAKO-YRNVUSSQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.