* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,2'-(2,5-FURANDIYL)BIS-1H-BENZIMIDAZOLE |
CAS: | 4751-41-1 |
English Synonyms: | 2,2'-(2,5-FURANDIYL)BIS-1H-BENZIMIDAZOLE |
MDL Number.: | MFCD00395316 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | c1ccc2c(c1)[nH]c(n2)c3ccc(o3)c4[nH]c5ccccc5n4 |
InChi: | InChI=1S/C18H12N4O/c1-2-6-12-11(5-1)19-17(20-12)15-9-10-16(23-15)18-21-13-7-3-4-8-14(13)22-18/h1-10H,(H,19,20)(H,21,22) |
InChiKey: | InChIKey=TZHPWEUMBMSGIS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.