* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-IODO-4-METHOXY-2-METHYL-PYRAZOLO[1,5-A][1,3,5]TRIAZINE |
CAS: | 476468-41-4 |
English Synonyms: | 8-IODO-4-METHOXY-2-METHYL-PYRAZOLO[1,5-A][1,3,5]TRIAZINE |
MDL Number.: | MFCD18073973 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | Cc1nc2c(cnn2c(n1)OC)I |
InChi: | InChI=1S/C7H7IN4O/c1-4-10-6-5(8)3-9-12(6)7(11-4)13-2/h3H,1-2H3 |
InChiKey: | InChIKey=MPYDQBPHPFJRCH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.