* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-ETHYLINDOLE |
CAS: | 4765-24-6 |
English Synonyms: | 6-ETHYL-1H-INDOLE ; 1H-INDOLE, 6-ETHYL- ; 6-ETHYLINDOLE |
MDL Number.: | MFCD11109873 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CCc1ccc2cc[nH]c2c1 |
InChi: | InChI=1S/C10H11N/c1-2-8-3-4-9-5-6-11-10(9)7-8/h3-7,11H,2H2,1H3 |
InChiKey: | InChIKey=NLAHUZMFMIIFDE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.