* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | N-(3-BR-PH)-2-((5-((4-METHOXYBENZYL)THIO)-1,3,4-THIADIAZOL-2-YL)THIO)ACETAMIDE |
| CAS: | 477313-74-9 |
| English Synonyms: | N-(3-BR-PH)-2-((5-((4-METHOXYBENZYL)THIO)-1,3,4-THIADIAZOL-2-YL)THIO)ACETAMIDE |
| MDL Number.: | MFCD03474173 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | COc1ccc(cc1)CSc2nnc(s2)SCC(=O)Nc3cccc(c3)Br |
| InChi: | InChI=1S/C18H16BrN3O2S3/c1-24-15-7-5-12(6-8-15)10-25-17-21-22-18(27-17)26-11-16(23)20-14-4-2-3-13(19)9-14/h2-9H,10-11H2,1H3,(H,20,23) |
| InChiKey: | InChIKey=SQJMPTZTFBDZCL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.