* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EMODIC ACID |
| CAS: | 478-45-5 |
| English Synonyms: | EMODIC ACID |
| MDL Number.: | MFCD01664529 |
| H bond acceptor: | 7 |
| H bond donor: | 4 |
| Smile: | c1c(cc(c2c1C(=O)c3cc(cc(c3C2=O)O)O)O)C(=O)O |
| InChi: | InChI=1S/C15H8O7/c16-6-3-8-12(10(18)4-6)14(20)11-7(13(8)19)1-5(15(21)22)2-9(11)17/h1-4,16-18H,(H,21,22) |
| InChiKey: | InChIKey=ZJXVNNSMRGTDBI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.