* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-(PROPAN-2-YL)-1H-INDAZOL-5-OL |
CAS: | 478840-21-0 |
English Synonyms: | 4-(PROPAN-2-YL)-1H-INDAZOL-5-OL ; INDAZOL-5-OL, 4-(1-METHYLETHYL)- |
MDL Number.: | MFCD17010100 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CC(C)c1c(ccc2c1cn[nH]2)O |
InChi: | InChI=1S/C10H12N2O/c1-6(2)10-7-5-11-12-8(7)3-4-9(10)13/h3-6,13H,1-2H3,(H,11,12) |
InChiKey: | InChIKey=HYSZUZGRINTERZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.