* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | LEVOXADROL |
| CAS: | 4792-18-1 |
| English Synonyms: | LEVOXADROL |
| MDL Number.: | MFCD00864424 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1ccc(cc1)C2(OC[C@@H](O2)C3CCCCN3)c4ccccc4 |
| InChi: | InChI=1S/C20H23NO2/c1-3-9-16(10-4-1)20(17-11-5-2-6-12-17)22-15-19(23-20)18-13-7-8-14-21-18/h1-6,9-12,18-19,21H,7-8,13-15H2/t18?,19-/m1/s1 |
| InChiKey: | InChIKey=HGKAMARNFGKMLC-MUMRKEEXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.