* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3',4',5,7-TETRAHYDROXYISOFLAVONE |
CAS: | 480-23-9 |
English Synonyms: | 3',4',5,7-TETRAHYDROXYISOFLAVONE ; OROBOL |
MDL Number.: | MFCD00210595 |
H bond acceptor: | 6 |
H bond donor: | 4 |
Smile: | c1cc(c(cc1c2coc3cc(cc(c3c2=O)O)O)O)O |
InChi: | InChI=1S/C15H10O6/c16-8-4-12(19)14-13(5-8)21-6-9(15(14)20)7-1-2-10(17)11(18)3-7/h1-6,16-19H |
InChiKey: | InChIKey=IOYHCQBYQJQBSK-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.