* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,2,3,4,6,7,12,12B-OCTAHYDROINDOLO(2,3-A)QUINOLIZINE |
CAS: | 4802-79-3 |
English Synonyms: | 1,2,3,4,6,7,12,12B-OCTAHYDROINDOLO(2,3-A)QUINOLIZINE |
MDL Number.: | MFCD00229607 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)c3c([nH]2)C4CCCCN4CC3 |
InChi: | InChI=1S/C15H18N2/c1-2-6-13-11(5-1)12-8-10-17-9-4-3-7-14(17)15(12)16-13/h1-2,5-6,14,16H,3-4,7-10H2 |
InChiKey: | InChIKey=OURDZMSSMGUMKR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.