* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4,4'-DIAZIDODIPHENYL ETHER |
CAS: | 48180-65-0 |
English Synonyms: | DADE ; 4,4'-DIAZIDODIPHENYL ETHER |
MDL Number.: | MFCD00216013 |
H bond acceptor: | 7 |
H bond donor: | 0 |
Smile: | c1cc(ccc1N=[N+]=[N-])Oc2ccc(cc2)N=[N+]=[N-] |
InChi: | InChI=1S/C12H8N6O/c13-17-15-9-1-5-11(6-2-9)19-12-7-3-10(4-8-12)16-18-14/h1-8H |
InChiKey: | InChIKey=BVKCTCWYHGXELK-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.