* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GLYCEROL, [2-14C] |
CAS: | 4819-42-5 |
English Synonyms: | GLYCEROL, [2-14C] |
MDL Number.: | MFCD00189770 |
H bond acceptor: | 3 |
H bond donor: | 3 |
Smile: | C([14CH](CO)O)O |
InChi: | InChI=1S/C3H8O3/c4-1-3(6)2-5/h3-6H,1-2H2/i3+2 |
InChiKey: | InChIKey=PEDCQBHIVMGVHV-YZRHJBSPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.