* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SARPAGINE |
| CAS: | 482-68-8 |
| English Synonyms: | SARPAGINE |
| MDL Number.: | MFCD00189439 |
| H bond acceptor: | 4 |
| H bond donor: | 3 |
| Smile: | C/C=C/1\CN2C3Cc4c5cc(ccc5[nH]c4[C@@H]2CC1C3CO)O |
| InChi: | InChI=1S/C19H22N2O2/c1-2-10-8-21-17-7-14-13-5-11(23)3-4-16(13)20-19(14)18(21)6-12(10)15(17)9-22/h2-5,12,15,17-18,20,22-23H,6-9H2,1H3/b10-2+/t12?,15?,17?,18-/m0/s1 |
| InChiKey: | InChIKey=VTVQHYQGTTVKDE-AIKFILLISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.