* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | THIENO[3,4-B][1,4]BENZODIOXIN |
CAS: | 484678-97-9 |
English Synonyms: | THIENO[3,4-B][1,4]BENZODIOXIN |
MDL Number.: | MFCD17014652 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1ccc2c(c1)Oc3cscc3O2 |
InChi: | InChI=1S/C10H6O2S/c1-2-4-8-7(3-1)11-9-5-13-6-10(9)12-8/h1-6H |
InChiKey: | InChIKey=LMGSINXRBULTRV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.