* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,8-DICHLORO-1-OCTENE |
CAS: | 485320-13-6 |
English Synonyms: | 2,8-DICHLORO-1-OCTENE ; 2,8-DICHLOROOCT-1-ENE |
MDL Number.: | MFCD00671830 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C=C(CCCCCCCl)Cl |
InChi: | InChI=1S/C8H14Cl2/c1-8(10)6-4-2-3-5-7-9/h1-7H2 |
InChiKey: | InChIKey=USNACSJJNIPRRX-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.