* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-CHLORO-2-METHYL-1-OCTENE |
CAS: | 485320-16-9 |
English Synonyms: | 8-CHLORO-2-METHYL-1-OCTENE ; 8-CHLORO-2-METHYLOCT-1-ENE |
MDL Number.: | MFCD00671836 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CC(=C)CCCCCCCl |
InChi: | InChI=1S/C9H17Cl/c1-9(2)7-5-3-4-6-8-10/h1,3-8H2,2H3 |
InChiKey: | InChIKey=WPPNRBVXACSCEG-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.