* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GAULTHERIN |
| CAS: | 490-67-5 |
| English Synonyms: | GAULTHERIN |
| MDL Number.: | MFCD09953809 |
| H bond acceptor: | 12 |
| H bond donor: | 6 |
| Smile: | COC(=O)c1ccccc1O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO[C@H]3[C@@H]([C@H]([C@H](O3)CO)O)O)O)O)O |
| InChi: | InChI=1S/C19H26O12/c1-27-17(26)8-4-2-3-5-9(8)29-19-16(25)14(23)13(22)11(31-19)7-28-18-15(24)12(21)10(6-20)30-18/h2-5,10-16,18-25H,6-7H2,1H3/t10-,11-,12+,13-,14+,15-,16-,18-,19-/m1/s1 |
| InChiKey: | InChIKey=XJOQBSUAJMEVGS-KFRLPSNLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.