* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-STYRYLQUINOLINE |
CAS: | 4945-26-0 |
English Synonyms: | 2-STYRYLQUINOLINE |
MDL Number.: | MFCD00193628 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | c1ccc(cc1)/C=C/c2ccc3ccccc3n2 |
InChi: | InChI=1S/C17H13N/c1-2-6-14(7-3-1)10-12-16-13-11-15-8-4-5-9-17(15)18-16/h1-13H/b12-10+ |
InChiKey: | InChIKey=RLGKSXCGHMXELQ-ZRDIBKRKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.