* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2H-Benzo[d][1,2,3]triazole-5-carboxylic acid |
CAS: | 49636-03-5 |
English Synonyms: | 2H-BENZO[D][1,2,3]TRIAZOLE-5-CARBOXYLIC ACID |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | N=1NN=C2C1C=CC(=C2)C(=O)O |
InChi: | InChI=1S/C7H5N3O2/c11-7(12)4-1-2-5-6(3-4)9-10-8-5/h1-3H,(H,11,12)(H,8,9,10) |
InChiKey: | InChIKey=GUOVBFFLXKJFEE-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.