* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(2-METHYL-1,3-DIOXOLAN-2-YL)PYRIDINE |
CAS: | 49669-15-0 |
English Synonyms: | 2-(2-METHYL-1,3-DIOXOLAN-2-YL)PYRIDINE |
MDL Number.: | MFCD00185150 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | CC1(OCCO1)c2ccccn2 |
InChi: | InChI=1S/C9H11NO2/c1-9(11-6-7-12-9)8-4-2-3-5-10-8/h2-5H,6-7H2,1H3 |
InChiKey: | InChIKey=PIMOKZUNAGGMDZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.