* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | CADMIUM CITRATE |
CAS: | 49707-39-3 |
English Synonyms: | CADMIUM CITRATE |
MDL Number.: | MFCD00050854 |
H bond acceptor: | 14 |
H bond donor: | 2 |
Smile: | C1C(=O)O[Cd]OC(=O)C1(CC(=O)O[Cd]OC(=O)CC2(CC(=O)O[Cd]OC2=O)O)O |
InChi: | InChI=1S/2C6H8O7.3Cd/c2*7-3(8)1-6(13,5(11)12)2-4(9)10;;;/h2*13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;;/q;;3*+2/p-6 |
InChiKey: | InChIKey=ROFFPTKOAWZFNP-UHFFFAOYSA-H |
* If the product has intellectual property rights, a license granted is must or contact us.