* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 3,3A,4,4A,5,7A,8,8A-OCTAHYDRO-4,8-METHANO-1H-INDENO[5,6-C]FURAN |
CAS: | 500570-91-2 |
English Synonyms: | 4,8-METHANO-1H-INDENO[5,6-C]FURAN, 3,3A,4,4A,5,7A,8,8A-OCTAHYDRO- ; 3,3A,4,4A,5,7A,8,8A-OCTAHYDRO-4,8-METHANO-1H-INDENO[5,6-C]FURAN |
MDL Number.: | MFCD18832851 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | C1C=CC2C1C3CC2C4C3COC4 |
InChi: | InChI=1S/C12H16O/c1-2-7-8(3-1)10-4-9(7)11-5-13-6-12(10)11/h1-2,7-12H,3-6H2 |
InChiKey: | InChIKey=FMBVYOJRAPLYTN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.