* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-PHENYL-1H-1,2,4-TRIAZOLE-5-CARBOXYLIC ACID |
CAS: | 500865-95-2 |
English Synonyms: | 1-PHENYL-1H-1,2,4-TRIAZOLE-5-CARBOXYLIC ACID |
MDL Number.: | MFCD18969167 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)n2c(ncn2)C(=O)O |
InChi: | InChI=1S/C9H7N3O2/c13-9(14)8-10-6-11-12(8)7-4-2-1-3-5-7/h1-6H,(H,13,14) |
InChiKey: | InChIKey=TXUMGEBWOCUGIS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.