* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2,4-OCTADIEN-1-AMINE, N,N-DIMETHYL-, (2Z,4E)- |
CAS: | 500911-39-7 |
English Synonyms: | 2,4-OCTADIEN-1-AMINE, N,N-DIMETHYL-, (2Z,4E)- |
MDL Number.: | MFCD18830243 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | CCC/C=C/C=C\CN(C)C |
InChi: | InChI=1S/C10H19N/c1-4-5-6-7-8-9-10-11(2)3/h6-9H,4-5,10H2,1-3H3/b7-6+,9-8- |
InChiKey: | InChIKey=FCQCNBDGGZGWMH-MUIOLIGRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.