* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-(4-TERT-BUTYLPHENYL)PYRIDINE |
| CAS: | 501074-90-4 |
| English Synonyms: | 4-(4-TERT-BUTYLPHENYL)PYRIDINE |
| MDL Number.: | MFCD15476039 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | CC(C)(C)c1ccc(cc1)c2ccncc2 |
| InChi: | InChI=1S/C15H17N/c1-15(2,3)14-6-4-12(5-7-14)13-8-10-16-11-9-13/h4-11H,1-3H3 |
| InChiKey: | InChIKey=FIDJLZPIZGTDKT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.