* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1H-Pyrazol-3-amine, 5-(2,5-dimethylphenyl)- |
CAS: | 501902-68-7 |
English Synonyms: | 1H-PYRAZOL-3-AMINE, 5-(2,5-DIMETHYLPHENYL)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CC1=C(C=C(C=C1)C)C1=CC(=NN1)N |
InChi: | InChI=1S/C11H13N3/c1-7-3-4-8(2)9(5-7)10-6-11(12)14-13-10/h3-6H,1-2H3,(H3,12,13,14) |
InChiKey: | InChIKey=DOKNEPPEEBJNJR-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.