* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-AMINO-5H-PYRROLO[3,2-D]PYRIMIDIN-6-OL |
CAS: | 501920-22-5 |
English Synonyms: | 5H-PYRROLO[3,2-D]PYRIMIDIN-6-OL, 4-AMINO- ; 4-AMINO-5H-PYRROLO[3,2-D]PYRIMIDIN-6-OL |
MDL Number.: | MFCD17013025 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | c1c2c(c(ncn2)N)[nH]c1O |
InChi: | InChI=1S/C6H6N4O/c7-6-5-3(8-2-9-6)1-4(11)10-5/h1-2,10-11H,(H2,7,8,9) |
InChiKey: | InChIKey=NKTNLWRCZLAWHB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.