* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1H,7H-OXAZOLO[3,4-A][1,3]DIAZEPINE |
CAS: | 502494-13-5 |
English Synonyms: | 1H,7H-OXAZOLO[3,4-A][1,3]DIAZEPINE |
MDL Number.: | MFCD18806891 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | C1N2C=CC=CNC2=CO1 |
InChi: | InChI=1S/C7H8N2O/c1-2-4-9-6-10-5-7(9)8-3-1/h1-5,8H,6H2 |
InChiKey: | InChIKey=PMXOVRTWOQFVTQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.