* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 4-(1H-BENZO[D][1,2,3]TRIAZOL-1-YLOXY)BUTANOIC ACID |
CAS: | 502648-92-2 |
English Synonyms: | 4-(1H-BENZO[D][1,2,3]TRIAZOL-1-YLOXY)BUTANOIC ACID |
MDL Number.: | MFCD09951809 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)nnn2OCCCC(=O)O |
InChi: | InChI=1S/C10H11N3O3/c14-10(15)6-3-7-16-13-9-5-2-1-4-8(9)11-12-13/h1-2,4-5H,3,6-7H2,(H,14,15) |
InChiKey: | InChIKey=NSKIZWKJNQYMBP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.