* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3,4-PYRROLIDINEDIOL, 2-(1-METHYLETHYL)-, (2S,3S,4S)- |
CAS: | 502841-33-0 |
English Synonyms: | 3,4-PYRROLIDINEDIOL, 2-(1-METHYLETHYL)-, (2S,3S,4S)- |
MDL Number.: | MFCD18828315 |
H bond acceptor: | 3 |
H bond donor: | 3 |
Smile: | CC(C)[C@H]1[C@@H]([C@H](CN1)O)O |
InChi: | InChI=1S/C7H15NO2/c1-4(2)6-7(10)5(9)3-8-6/h4-10H,3H2,1-2H3/t5-,6-,7+/m0/s1 |
InChiKey: | InChIKey=KHGOWMSTRYRYPU-LYFYHCNISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.