* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FLUNAMINE |
| CAS: | 50366-32-0 |
| English Synonyms: | FLUNAMINE |
| MDL Number.: | MFCD00868663 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | c1cc(ccc1C(c2ccc(cc2)F)OCCN)F |
| InChi: | InChI=1S/C15H15F2NO/c16-13-5-1-11(2-6-13)15(19-10-9-18)12-3-7-14(17)8-4-12/h1-8,15H,9-10,18H2 |
| InChiKey: | InChIKey=BBEDRGWUDRUNQC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.