* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3,4,7,8-TETRAHYDRO-2H-PYRIDO[1,2-A]PYRAZIN-1(6H)-ONE |
CAS: | 50369-64-7 |
English Synonyms: | 3,4,7,8-TETRAHYDRO-2H-PYRIDO[1,2-A]PYRAZIN-1(6H)-ONE ; 2H-PYRIDO[1,2-A]PYRAZIN-1(6H)-ONE, 3,4,7,8-TETRAHYDRO- |
MDL Number.: | MFCD18814998 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | C1CC=C2C(=O)NCCN2C1 |
InChi: | InChI=1S/C8H12N2O/c11-8-7-3-1-2-5-10(7)6-4-9-8/h3H,1-2,4-6H2,(H,9,11) |
InChiKey: | InChIKey=HBRSWIOISCOVNK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.