* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 3,7-METHANO-1H-PYRROLO[2,1-C][1,4]OXAZINE |
CAS: | 504411-02-3 |
English Synonyms: | 3,7-METHANO-1H-PYRROLO[2,1-C][1,4]OXAZINE |
MDL Number.: | MFCD18817496 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1c2cn3c1COC(=C3)C2 |
InChi: | InChI=1S/C8H7NO/c1-6-2-8-4-9(3-6)7(1)5-10-8/h1,3-4H,2,5H2 |
InChiKey: | InChIKey=KJWNTHLYHFETPN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.