* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | (+/-)-11(12)-EPOXY-5Z,8Z,14Z,17Z-EICOSATETRAENOIC ACID |
CAS: | 504435-15-8 |
English Synonyms: | (+/-)-11(12)-EPOXY-5Z,8Z,14Z,17Z-EICOSATETRAENOIC ACID ; 11(12)-EPETE |
MDL Number.: | MFCD18427995 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC/C=C\C/C=C\CC1C(O1)C/C=C\C/C=C\CCCC(=O)O |
InChi: | InChI=1S/C20H30O3/c1-2-3-4-5-9-12-15-18-19(23-18)16-13-10-7-6-8-11-14-17-20(21)22/h3-4,6,8-10,12-13,18-19H,2,5,7,11,14-17H2,1H3,(H,21,22)/b4-3-,8-6-,12-9-,13-10- |
InChiKey: | InChIKey=QHOKDYBJJBDJGY-BVILWSOJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.