* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5,7-DICHLORO-1H-INDAZOLE |
CAS: | 50477-27-5 |
English Synonyms: | 5,7-DICHLORO-1H-INDAZOLE |
MDL Number.: | MFCD16877653 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1c(cc(c2c1cn[nH]2)Cl)Cl |
InChi: | InChI=1S/C7H4Cl2N2/c8-5-1-4-3-10-11-7(4)6(9)2-5/h1-3H,(H,10,11) |
InChiKey: | InChIKey=PSGBPRKFNRSLBQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.