* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9H-PYRIMIDO[4,5-B]INDOLE |
CAS: | 5059-31-4 |
English Synonyms: | 9H-PYRIMIDO[4,5-B]INDOLE |
MDL Number.: | MFCD02066296 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)c3cncnc3[nH]2 |
InChi: | InChI=1S/C10H7N3/c1-2-4-9-7(3-1)8-5-11-6-12-10(8)13-9/h1-6H,(H,11,12,13) |
InChiKey: | InChIKey=IEJAIKPHVAPFSS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.