* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 3-CHLORO-BICYCLO[3.2.1]OCTA-3,6-DIEN-2-ONE |
CAS: | 50590-75-5 |
English Synonyms: | BICYCLO[3.2.1]OCTA-3,6-DIEN-2-ONE, 3-CHLORO- ; 3-CHLORO-BICYCLO[3.2.1]OCTA-3,6-DIEN-2-ONE |
MDL Number.: | MFCD18826998 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | C1C2C=CC1C(=O)C(=C2)Cl |
InChi: | InChI=1S/C8H7ClO/c9-7-4-5-1-2-6(3-5)8(7)10/h1-2,4-6H,3H2 |
InChiKey: | InChIKey=LAYBWZOWNHYPND-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.