* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | EMOLECULES 30264919 |
CAS: | 50596-93-5 |
English Synonyms: | EMOLECULES 30264919 |
MDL Number.: | MFCD18084097 |
H bond acceptor: | 3 |
H bond donor: | 3 |
Smile: | c1ccc(cc1)CNC(=S)Nc2ccccc2N |
InChi: | InChI=1S/C14H15N3S/c15-12-8-4-5-9-13(12)17-14(18)16-10-11-6-2-1-3-7-11/h1-9H,10,15H2,(H2,16,17,18) |
InChiKey: | InChIKey=KRJFMHAJXWUTGY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.