* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-(TERT-BUTYL)-1H-PURIN-6-AMINE |
| CAS: | 50609-20-6 |
| English Synonyms: | 8-(TERT-BUTYL)-1H-PURIN-6-AMINE |
| MDL Number.: | MFCD22207527 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CC(C)(C)c1nc-2c([nH]cnc2n1)N |
| InChi: | InChI=1S/C9H13N5/c1-9(2,3)8-13-5-6(10)11-4-12-7(5)14-8/h4H,1-3H3,(H3,10,11,12,13,14) |
| InChiKey: | InChIKey=LSOOEJSTVYZUEI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.