* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-ETHYL-2-HEXEN-1-OL |
CAS: | 50639-00-4 |
English Synonyms: | 2-ETHYL-2-HEXEN-1-OL ; (2E)-2-ETHYLHEX-2-EN-1-OL |
MDL Number.: | MFCD00022003 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CCC/C=C(\CC)/CO |
InChi: | InChI=1S/C8H16O/c1-3-5-6-8(4-2)7-9/h6,9H,3-5,7H2,1-2H3/b8-6+ |
InChiKey: | InChIKey=JSRFYJBJQPGAAA-SOFGYWHQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.