* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | JATROPHAM |
| CAS: | 50656-76-3 ;37772-60-4 |
| English Synonyms: | (5R)-1,5-DIHYDRO-5-HYDROXY-3-METHYL-2H-PYRROL-2-ONE ; JATROPHAM |
| MDL Number.: | MFCD09837924 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | CC1=C[C@H](NC1=O)O |
| InChi: | InChI=1S/C5H7NO2/c1-3-2-4(7)6-5(3)8/h2,4,7H,1H3,(H,6,8)/t4-/m1/s1 |
| InChiKey: | InChIKey=DORDKUBCRPNETF-SCSAIBSYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.