* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | NIRANTHIN |
CAS: | 50656-77-4 |
English Synonyms: | NIRANTHIN |
MDL Number.: | MFCD09970365 |
H bond acceptor: | 7 |
H bond donor: | 0 |
Smile: | COC[C@H](Cc1ccc(c(c1)OC)OC)[C@@H](Cc2cc3c(c(c2)OC)OCO3)COC |
InChi: | InChI=1S/C24H32O7/c1-25-13-18(8-16-6-7-20(27-3)21(10-16)28-4)19(14-26-2)9-17-11-22(29-5)24-23(12-17)30-15-31-24/h6-7,10-12,18-19H,8-9,13-15H2,1-5H3/t18-,19-/m0/s1 |
InChiKey: | InChIKey=RCFGIEPQSDGMJJ-OALUTQOASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.