* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2-AMINO-OCTANE-1,3-DIOL |
CAS: | 50731-01-6 |
English Synonyms: | 2-AMINO-OCTANE-1,3-DIOL |
MDL Number.: | MFCD18381968 |
H bond acceptor: | 3 |
H bond donor: | 3 |
Smile: | CCCCCC(C(CO)N)O |
InChi: | InChI=1S/C8H19NO2/c1-2-3-4-5-8(11)7(9)6-10/h7-8,10-11H,2-6,9H2,1H3 |
InChiKey: | InChIKey=XIPFVVMFKMZFEH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.