* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2-BROMO-3-METHYL-1-PHENYLBUTAN-1-ONE |
CAS: | 50735-03-0 |
English Synonyms: | 2-BROMO-3-METHYL-1-PHENYLBUTAN-1-ONE |
MDL Number.: | MFCD10000559 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | CC(C)C(C(=O)c1ccccc1)Br |
InChi: | InChI=1S/C11H13BrO/c1-8(2)10(12)11(13)9-6-4-3-5-7-9/h3-8,10H,1-2H3 |
InChiKey: | InChIKey=UCCCJNBTIJWCPF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.