Molecular Structure:
CAS No.:
50787-02-5
Product Name.:
CCD No.:CCD04475263
Formula:C10 H11 N5 O4
MolWeight:265.228
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(3)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ACETAMIDE, N-(1,2,3,4,5,6-HEXAHYDRO-1,3-DIMETHYL-2,4,6-TRIOXO-7-PTERIDINYL)- |
| CAS： | 50787-02-5 |
| English Synonyms： | N-(1,2,3,4,5,6-HEXAHYDRO-1,3-DIMETHYL-2,4,6-TRIOXO-7-PTERIDINYL)-ACETAMIDE ; ACETAMIDE, N-(1,2,3,4,5,6-HEXAHYDRO-1,3-DIMETHYL-2,4,6-TRIOXO-7-PTERIDINYL)- |
| MDL Number.： | MFCD18823392 |
| H bond acceptor： | 9 |
| H bond donor： | 2 |
| Smile： | CC(=O)Nc1c(=O)[nH]c2c(n1)n(c(=O)n(c2=O)C)C |
| InChi： | InChI=1S/C10H11N5O4/c1-4(16)11-6-8(17)12-5-7(13-6)14(2)10(19)15(3)9(5)18/h1-3H3,(H,12,17)(H,11,13,16) |
| InChiKey： | InChIKey=PGUBNJBASQBRMV-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
