* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | TRICYCLENE |
CAS: | 508-32-7 |
English Synonyms: | TRICYCLENE ; 1,7,7-TRIMETHYLTRICYCLO[2,2,1,02.6]HEPTANE |
MDL Number.: | MFCD00167982 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CC1([C@@H]2C[C@@H]3[C@]1([C@@H]3C2)C)C |
InChi: | InChI=1S/C10H16/c1-9(2)6-4-7-8(5-6)10(7,9)3/h6-8H,4-5H2,1-3H3/t6-,7+,8-,10+ |
InChiKey: | InChIKey=RRBYUSWBLVXTQN-UICFKRDXSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.