* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | Z-TYR-ILE-OH |
CAS: | 50903-76-9 |
English Synonyms: | Z-TYR-ILE-OH |
MDL Number.: | MFCD00238511 |
H bond acceptor: | 8 |
H bond donor: | 4 |
Smile: | CC[C@H](C)[C@@H](C(=O)O)NC(=O)[C@H](Cc1ccc(cc1)O)NC(=O)OCc2ccccc2 |
InChi: | InChI=1S/C23H28N2O6/c1-3-15(2)20(22(28)29)25-21(27)19(13-16-9-11-18(26)12-10-16)24-23(30)31-14-17-7-5-4-6-8-17/h4-12,15,19-20,26H,3,13-14H2,1-2H3,(H,24,30)(H,25,27)(H,28,29)/t15-,19-,20-/m0/s1 |
InChiKey: | InChIKey=OSLWPNZZCNJZTH-YSSFQJQWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.